C18H22N2 — CID 28721177
3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]aniline (PubChem CID 28721177) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]aniline.
| Compound Name | 3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]aniline |
|---|---|
| PubChem CID | 28721177 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]aniline |
| SMILES | Nc1cccc(CCCN2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H22N2/c19-18-9-3-5-15(13-18)6-4-11-20-12-10-16-7-1-2-8-17(16)14-20/h1-3,5,7-9,13H,4,6,10-12,14,19H2 |
| InChIKey | BTRNGSPUULZAMF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|