C15H18N2O3 — CID 115342383
(E)-3-[4-[(3-methylpyrrolidine-3-carbonyl)amino]phenyl]prop-2-enoic acid (PubChem CID 115342383) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (E)-3-[4-[(3-methylpyrrolidine-3-carbonyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(3-methylpyrrolidine-3-carbonyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115342383 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (E)-3-[4-[(3-methylpyrrolidine-3-carbonyl)amino]phenyl]prop-2-enoic acid |
| SMILES | CC1(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)CCNC1 |
| InChI | InChI=1S/C15H18N2O3/c1-15(8-9-16-10-15)14(20)17-12-5-2-11(3-6-12)4-7-13(18)19/h2-7,16H,8-10H2,1H3,(H,17,20)(H,18,19)/b7-4+ |
| InChIKey | PPGYVDGTZKAEOT-QPJJXVBHSA-N |
| XLogP | 1.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|