C14H11N5O — CID 115342427
4-[(E)-2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethenyl]aniline (PubChem CID 115342427) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is 4-[(E)-2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethenyl]aniline.
| Compound Name | 4-[(E)-2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 115342427 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[(E)-2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethenyl]aniline |
| SMILES | Nc1ccc(/C=C/c2nc(-c3cnccn3)no2)cc1 |
| InChI | InChI=1S/C14H11N5O/c15-11-4-1-10(2-5-11)3-6-13-18-14(19-20-13)12-9-16-7-8-17-12/h1-9H,15H2/b6-3+ |
| InChIKey | JOIDJCDDWDDHFF-ZZXKWVIFSA-N |
| XLogP | 2.28 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|