C14H25BrN4 — CID 115347087
5-bromo-2-[2-(dimethylamino)ethyl]-N-ethyl-6-(2-methylpropyl)pyrimidin-4-amine (PubChem CID 115347087) has the molecular formula C14H25BrN4 and a molecular weight of 329.29 g/mol. Its IUPAC name is 5-bromo-2-[2-(dimethylamino)ethyl]-N-ethyl-6-(2-methylpropyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-2-[2-(dimethylamino)ethyl]-N-ethyl-6-(2-methylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115347087 |
| Molecular Formula | C14H25BrN4 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 5-bromo-2-[2-(dimethylamino)ethyl]-N-ethyl-6-(2-methylpropyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(CCN(C)C)nc(CC(C)C)c1Br |
| InChI | InChI=1S/C14H25BrN4/c1-6-16-14-13(15)11(9-10(2)3)17-12(18-14)7-8-19(4)5/h10H,6-9H2,1-5H3,(H,16,17,18) |
| InChIKey | HBTHPOYIWWSYFK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |