C4H6ClF2NO — CID 115349396
2-chloro-N-(2,2-difluoroethyl)acetamide (PubChem CID 115349396) has the molecular formula C4H6ClF2NO and a molecular weight of 157.55 g/mol. Its IUPAC name is 2-chloro-N-(2,2-difluoroethyl)acetamide.
| Compound Name | 2-chloro-N-(2,2-difluoroethyl)acetamide |
|---|---|
| PubChem CID | 115349396 |
| Molecular Formula | C4H6ClF2NO |
| Molecular Weight | 157.55 g/mol |
| Exact Mass | 157.01 |
| IUPAC Name | 2-chloro-N-(2,2-difluoroethyl)acetamide |
| SMILES | O=C(CCl)NCC(F)F |
| InChI | InChI=1S/C4H6ClF2NO/c5-1-4(9)8-2-3(6)7/h3H,1-2H2,(H,8,9) |
| InChIKey | DABSPSSDKVBEMP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.55 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|