C15H19ClO4S — CID 115349559
3-[chloro-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]thiolane 1,1-dioxide (PubChem CID 115349559) has the molecular formula C15H19ClO4S and a molecular weight of 330.83 g/mol. Its IUPAC name is 3-[chloro-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[chloro-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 115349559 |
| Molecular Formula | C15H19ClO4S |
| Molecular Weight | 330.83 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-[chloro-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]thiolane 1,1-dioxide |
| SMILES | COc1cc2c(cc1C(Cl)C1CCS(=O)(=O)C1)OC(C)C2 |
| InChI | InChI=1S/C15H19ClO4S/c1-9-5-11-6-14(19-2)12(7-13(11)20-9)15(16)10-3-4-21(17,18)8-10/h6-7,9-10,15H,3-5,8H2,1-2H3 |
| InChIKey | QUSXKLBPFBJAMA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.83 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|