C33H29F3N4O7S2 — CID 11534966
N-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-4-phenylbenzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 11534966) has the molecular formula C33H29F3N4O7S2 and a molecular weight of 714.74 g/mol. Its IUPAC name is N-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-4-phenylbenzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-4-phenylbenzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11534966 |
| Molecular Formula | C33H29F3N4O7S2 |
| Molecular Weight | 714.74 g/mol |
| Exact Mass | 714.14 |
| IUPAC Name | N-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-4-phenylbenzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc2nc([C@H](Cc3ccc(C4CC(=O)NS4(=O)=O)cc3)NS(=O)(=O)c3ccc(-c4ccccc4)cc3)[nH]c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H28N4O5S2.C2HF3O2/c1-20-7-16-26-27(17-20)33-31(32-26)28(18-21-8-10-24(11-9-21)29-19-30(36)35-42(29,39)40)34-41(37,38)25-14-12-23(13-15-25)22-5-3-2-4-6-22;3-2(4,5)1(6)7/h2-17,28-29,34H,18-19H2,1H3,(H,32,33)(H,35,36);(H,6,7)/t28-,29?;/m0./s1 |
| InChIKey | ZVALFJQRIBHKBS-MKSHZDIXSA-N |
| XLogP | 5.32 |
| TPSA | 175.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.74 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |