C14H18F3NO — CID 115358870
[1-[[(3,4,5-trifluorophenyl)methylamino]methyl]cyclopentyl]methanol (PubChem CID 115358870) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is [1-[[(3,4,5-trifluorophenyl)methylamino]methyl]cyclopentyl]methanol.
| Compound Name | [1-[[(3,4,5-trifluorophenyl)methylamino]methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 115358870 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | [1-[[(3,4,5-trifluorophenyl)methylamino]methyl]cyclopentyl]methanol |
| SMILES | OCC1(CNCc2cc(F)c(F)c(F)c2)CCCC1 |
| InChI | InChI=1S/C14H18F3NO/c15-11-5-10(6-12(16)13(11)17)7-18-8-14(9-19)3-1-2-4-14/h5-6,18-19H,1-4,7-9H2 |
| InChIKey | KNANLMJEZLZMNB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|