C13H27NO2 — CID 115359250
2,2-dimethyl-3-[(2-propan-2-yloxan-4-yl)amino]propan-1-ol (PubChem CID 115359250) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(2-propan-2-yloxan-4-yl)amino]propan-1-ol.
| Compound Name | 2,2-dimethyl-3-[(2-propan-2-yloxan-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 115359250 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2,2-dimethyl-3-[(2-propan-2-yloxan-4-yl)amino]propan-1-ol |
| SMILES | CC(C)C1CC(NCC(C)(C)CO)CCO1 |
| InChI | InChI=1S/C13H27NO2/c1-10(2)12-7-11(5-6-16-12)14-8-13(3,4)9-15/h10-12,14-15H,5-9H2,1-4H3 |
| InChIKey | NSMOKXOFHMVKII-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |