C16H27NOS — CID 80526351
N-(2-methyl-2-thiophen-2-ylpropyl)-2-propan-2-yloxan-4-amine (PubChem CID 80526351) has the molecular formula C16H27NOS and a molecular weight of 281.46 g/mol. Its IUPAC name is N-(2-methyl-2-thiophen-2-ylpropyl)-2-propan-2-yloxan-4-amine.
| Compound Name | N-(2-methyl-2-thiophen-2-ylpropyl)-2-propan-2-yloxan-4-amine |
|---|---|
| PubChem CID | 80526351 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-(2-methyl-2-thiophen-2-ylpropyl)-2-propan-2-yloxan-4-amine |
| SMILES | CC(C)C1CC(NCC(C)(C)c2cccs2)CCO1 |
| InChI | InChI=1S/C16H27NOS/c1-12(2)14-10-13(7-8-18-14)17-11-16(3,4)15-6-5-9-19-15/h5-6,9,12-14,17H,7-8,10-11H2,1-4H3 |
| InChIKey | QKJNPFYXZRXTSU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |