C12H17ClO3 — CID 11536072
ethyl 2-(chloromethyl)-2,3,3a,4,5,6-hexahydro-1-benzofuran-7-carboxylate (PubChem CID 11536072) has the molecular formula C12H17ClO3 and a molecular weight of 244.72 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-2,3,3a,4,5,6-hexahydro-1-benzofuran-7-carboxylate.
| Compound Name | ethyl 2-(chloromethyl)-2,3,3a,4,5,6-hexahydro-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 11536072 |
| Molecular Formula | C12H17ClO3 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | ethyl 2-(chloromethyl)-2,3,3a,4,5,6-hexahydro-1-benzofuran-7-carboxylate |
| SMILES | CCOC(=O)C1=C2OC(CCl)CC2CCC1 |
| InChI | InChI=1S/C12H17ClO3/c1-2-15-12(14)10-5-3-4-8-6-9(7-13)16-11(8)10/h8-9H,2-7H2,1H3 |
| InChIKey | KQPSQPUIHZYNQS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|