C10H14Cl2O2 — CID 10444151
(3E,4R,5R)-3-(1-chloroethylidene)-4-(chloromethyl)-5-propyloxolan-2-one (PubChem CID 10444151) has the molecular formula C10H14Cl2O2 and a molecular weight of 237.13 g/mol. Its IUPAC name is (3E,4R,5R)-3-(1-chloroethylidene)-4-(chloromethyl)-5-propyloxolan-2-one.
| Compound Name | (3E,4R,5R)-3-(1-chloroethylidene)-4-(chloromethyl)-5-propyloxolan-2-one |
|---|---|
| PubChem CID | 10444151 |
| Molecular Formula | C10H14Cl2O2 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (3E,4R,5R)-3-(1-chloroethylidene)-4-(chloromethyl)-5-propyloxolan-2-one |
| SMILES | CCC[C@H]1OC(=O)/C(=C(\C)Cl)[C@H]1CCl |
| InChI | InChI=1S/C10H14Cl2O2/c1-3-4-8-7(5-11)9(6(2)12)10(13)14-8/h7-8H,3-5H2,1-2H3/b9-6+/t7-,8+/m0/s1 |
| InChIKey | MDOOAUACQGKOFC-HNEQRXQUSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|