C10H12Cl2O2 — CID 10889871
(3Z,3aR,6aR)-3-(1-chloroethylidene)-5-(chloromethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one (PubChem CID 10889871) has the molecular formula C10H12Cl2O2 and a molecular weight of 235.11 g/mol. Its IUPAC name is (3Z,3aR,6aR)-3-(1-chloroethylidene)-5-(chloromethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one.
| Compound Name | (3Z,3aR,6aR)-3-(1-chloroethylidene)-5-(chloromethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10889871 |
| Molecular Formula | C10H12Cl2O2 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | (3Z,3aR,6aR)-3-(1-chloroethylidene)-5-(chloromethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-one |
| SMILES | C/C(Cl)=C1/C(=O)O[C@@H]2CC(CCl)C[C@H]12 |
| InChI | InChI=1S/C10H12Cl2O2/c1-5(12)9-7-2-6(4-11)3-8(7)14-10(9)13/h6-8H,2-4H2,1H3/b9-5-/t6?,7-,8+/m0/s1 |
| InChIKey | ULNNZJOWNBGJIM-ROMBYWPUSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|