C12H18Cl2O2 — CID 57359525
(4R,5R)-3-(1-chloroethylidene)-4-(chloromethyl)-5-pentyloxolan-2-one (PubChem CID 57359525) has the molecular formula C12H18Cl2O2 and a molecular weight of 265.18 g/mol. Its IUPAC name is (4R,5R)-3-(1-chloroethylidene)-4-(chloromethyl)-5-pentyloxolan-2-one.
| Compound Name | (4R,5R)-3-(1-chloroethylidene)-4-(chloromethyl)-5-pentyloxolan-2-one |
|---|---|
| PubChem CID | 57359525 |
| Molecular Formula | C12H18Cl2O2 |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (4R,5R)-3-(1-chloroethylidene)-4-(chloromethyl)-5-pentyloxolan-2-one |
| SMILES | CCCCC[C@H]1OC(=O)C(=C(C)Cl)[C@H]1CCl |
| InChI | InChI=1S/C12H18Cl2O2/c1-3-4-5-6-10-9(7-13)11(8(2)14)12(15)16-10/h9-10H,3-7H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | NIKSZNCLUJQDGP-VHSXEESVSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|