C9H18N2S2 — CID 115361656
5,5-dimethyl-N-(2-methylsulfanylethyl)-4,6-dihydro-1,3-thiazin-2-amine (PubChem CID 115361656) has the molecular formula C9H18N2S2 and a molecular weight of 218.39 g/mol. Its IUPAC name is 5,5-dimethyl-N-(2-methylsulfanylethyl)-4,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | 5,5-dimethyl-N-(2-methylsulfanylethyl)-4,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 115361656 |
| Molecular Formula | C9H18N2S2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 5,5-dimethyl-N-(2-methylsulfanylethyl)-4,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CSCCNC1=NCC(C)(C)CS1 |
| InChI | InChI=1S/C9H18N2S2/c1-9(2)6-11-8(13-7-9)10-4-5-12-3/h4-7H2,1-3H3,(H,10,11) |
| InChIKey | MYCUTEGCHYSMJT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|