C19H20N2O4S — CID 1153633
(2S)-2-amino-3-methyl-3-[(3S)-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl]sulfanylbutanoic acid (PubChem CID 1153633) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-3-[(3S)-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl]sulfanylbutanoic acid.
| Compound Name | (2S)-2-amino-3-methyl-3-[(3S)-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 1153633 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2S)-2-amino-3-methyl-3-[(3S)-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl]sulfanylbutanoic acid |
| SMILES | CC(C)(S[C@H]1CC(=O)N(c2cccc3ccccc23)C1=O)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C19H20N2O4S/c1-19(2,16(20)18(24)25)26-14-10-15(22)21(17(14)23)13-9-5-7-11-6-3-4-8-12(11)13/h3-9,14,16H,10,20H2,1-2H3,(H,24,25)/t14-,16-/m0/s1 |
| InChIKey | NSWWTVWUNAQUQG-HOCLYGCPSA-N |
| XLogP | 2.40 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|