C12H18BrN3O — CID 115364123
N-[[1-(bromomethyl)cyclopentyl]methyl]-1-methylpyrazole-4-carboxamide (PubChem CID 115364123) has the molecular formula C12H18BrN3O and a molecular weight of 300.20 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclopentyl]methyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[[1-(bromomethyl)cyclopentyl]methyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 115364123 |
| Molecular Formula | C12H18BrN3O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-[[1-(bromomethyl)cyclopentyl]methyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCC2(CBr)CCCC2)cn1 |
| InChI | InChI=1S/C12H18BrN3O/c1-16-7-10(6-15-16)11(17)14-9-12(8-13)4-2-3-5-12/h6-7H,2-5,8-9H2,1H3,(H,14,17) |
| InChIKey | OLHIAMACIROEND-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|