C12H21N3O2S — CID 115365959
N-(3-amino-2,2-dimethylpropyl)-2-pyridin-2-ylethanesulfonamide (PubChem CID 115365959) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-2-pyridin-2-ylethanesulfonamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-2-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 115365959 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-2-pyridin-2-ylethanesulfonamide |
| SMILES | CC(C)(CN)CNS(=O)(=O)CCc1ccccn1 |
| InChI | InChI=1S/C12H21N3O2S/c1-12(2,9-13)10-15-18(16,17)8-6-11-5-3-4-7-14-11/h3-5,7,15H,6,8-10,13H2,1-2H3 |
| InChIKey | SOYCRDAOTJPSJI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |