C16H19FN2 — CID 115367032
4-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-fluorobenzonitrile (PubChem CID 115367032) has the molecular formula C16H19FN2 and a molecular weight of 258.34 g/mol. Its IUPAC name is 4-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-fluorobenzonitrile.
| Compound Name | 4-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 115367032 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-fluorobenzonitrile |
| SMILES | CC(Nc1ccc(C#N)c(F)c1)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H19FN2/c1-10(15-7-11-2-3-12(15)6-11)19-14-5-4-13(9-18)16(17)8-14/h4-5,8,10-12,15,19H,2-3,6-7H2,1H3 |
| InChIKey | MAIKUSIBQNFXPO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |