C12H14F4N2S — CID 115368172
2-fluoro-4-[propyl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide (PubChem CID 115368172) has the molecular formula C12H14F4N2S and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-fluoro-4-[propyl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide.
| Compound Name | 2-fluoro-4-[propyl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 115368172 |
| Molecular Formula | C12H14F4N2S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-fluoro-4-[propyl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide |
| SMILES | CCCN(CC(F)(F)F)c1ccc(C(N)=S)c(F)c1 |
| InChI | InChI=1S/C12H14F4N2S/c1-2-5-18(7-12(14,15)16)8-3-4-9(11(17)19)10(13)6-8/h3-4,6H,2,5,7H2,1H3,(H2,17,19) |
| InChIKey | DHVCGXBTOHZJPJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|