C15H12Br2F2O — CID 115370122
1-[2-bromo-2-(4-bromo-2-methoxyphenyl)ethyl]-2,4-difluorobenzene (PubChem CID 115370122) has the molecular formula C15H12Br2F2O and a molecular weight of 406.06 g/mol. Its IUPAC name is 1-[2-bromo-2-(4-bromo-2-methoxyphenyl)ethyl]-2,4-difluorobenzene.
| Compound Name | 1-[2-bromo-2-(4-bromo-2-methoxyphenyl)ethyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 115370122 |
| Molecular Formula | C15H12Br2F2O |
| Molecular Weight | 406.06 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | 1-[2-bromo-2-(4-bromo-2-methoxyphenyl)ethyl]-2,4-difluorobenzene |
| SMILES | COc1cc(Br)ccc1C(Br)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H12Br2F2O/c1-20-15-7-10(16)3-5-12(15)13(17)6-9-2-4-11(18)8-14(9)19/h2-5,7-8,13H,6H2,1H3 |
| InChIKey | QIYUNFKCVCFBPM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.06 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|