C17H17BrF2O — CID 83044581
5-[1-bromo-2-(2,4-difluorophenyl)ethyl]-2-methoxy-1,3-dimethylbenzene (PubChem CID 83044581) has the molecular formula C17H17BrF2O and a molecular weight of 355.22 g/mol. Its IUPAC name is 5-[1-bromo-2-(2,4-difluorophenyl)ethyl]-2-methoxy-1,3-dimethylbenzene.
| Compound Name | 5-[1-bromo-2-(2,4-difluorophenyl)ethyl]-2-methoxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 83044581 |
| Molecular Formula | C17H17BrF2O |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 5-[1-bromo-2-(2,4-difluorophenyl)ethyl]-2-methoxy-1,3-dimethylbenzene |
| SMILES | COc1c(C)cc(C(Br)Cc2ccc(F)cc2F)cc1C |
| InChI | InChI=1S/C17H17BrF2O/c1-10-6-13(7-11(2)17(10)21-3)15(18)8-12-4-5-14(19)9-16(12)20/h4-7,9,15H,8H2,1-3H3 |
| InChIKey | NHPXESZVPDOTIT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|