C14H19BrO — CID 83068659
5-(1-bromo-2-cyclopropylethyl)-2-methoxy-1,3-dimethylbenzene (PubChem CID 83068659) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is 5-(1-bromo-2-cyclopropylethyl)-2-methoxy-1,3-dimethylbenzene.
| Compound Name | 5-(1-bromo-2-cyclopropylethyl)-2-methoxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 83068659 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-(1-bromo-2-cyclopropylethyl)-2-methoxy-1,3-dimethylbenzene |
| SMILES | COc1c(C)cc(C(Br)CC2CC2)cc1C |
| InChI | InChI=1S/C14H19BrO/c1-9-6-12(7-10(2)14(9)16-3)13(15)8-11-4-5-11/h6-7,11,13H,4-5,8H2,1-3H3 |
| InChIKey | HRTYFLMDZHPZAF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|