C15H21BrO2 — CID 114827053
4-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-2-methyloxolane (PubChem CID 114827053) has the molecular formula C15H21BrO2 and a molecular weight of 313.24 g/mol. Its IUPAC name is 4-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-2-methyloxolane.
| Compound Name | 4-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-2-methyloxolane |
|---|---|
| PubChem CID | 114827053 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]-2-methyloxolane |
| SMILES | COc1c(C)cc(C(Br)C2COC(C)C2)cc1C |
| InChI | InChI=1S/C15H21BrO2/c1-9-5-12(6-10(2)15(9)17-4)14(16)13-7-11(3)18-8-13/h5-6,11,13-14H,7-8H2,1-4H3 |
| InChIKey | UWSWPVMINKOTHR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|