C14H18Br2O3 — CID 114826925
4-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyloxolane (PubChem CID 114826925) has the molecular formula C14H18Br2O3 and a molecular weight of 394.10 g/mol. Its IUPAC name is 4-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyloxolane.
| Compound Name | 4-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyloxolane |
|---|---|
| PubChem CID | 114826925 |
| Molecular Formula | C14H18Br2O3 |
| Molecular Weight | 394.10 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 4-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methyloxolane |
| SMILES | COc1cc(Br)c(C(Br)C2COC(C)C2)cc1OC |
| InChI | InChI=1S/C14H18Br2O3/c1-8-4-9(7-19-8)14(16)10-5-12(17-2)13(18-3)6-11(10)15/h5-6,8-9,14H,4,7H2,1-3H3 |
| InChIKey | PIPFEUHFPXEAAY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.10 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|