C16H22Br2O3 — CID 62905177
4-[bromo-(2-bromo-4,5-diethoxyphenyl)methyl]oxane (PubChem CID 62905177) has the molecular formula C16H22Br2O3 and a molecular weight of 422.16 g/mol. Its IUPAC name is 4-[bromo-(2-bromo-4,5-diethoxyphenyl)methyl]oxane.
| Compound Name | 4-[bromo-(2-bromo-4,5-diethoxyphenyl)methyl]oxane |
|---|---|
| PubChem CID | 62905177 |
| Molecular Formula | C16H22Br2O3 |
| Molecular Weight | 422.16 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 4-[bromo-(2-bromo-4,5-diethoxyphenyl)methyl]oxane |
| SMILES | CCOc1cc(Br)c(C(Br)C2CCOCC2)cc1OCC |
| InChI | InChI=1S/C16H22Br2O3/c1-3-20-14-9-12(13(17)10-15(14)21-4-2)16(18)11-5-7-19-8-6-11/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | SKQIUUQPDNDXST-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.16 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|