About 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one
1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one (PubChem CID 115371155) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one |
| PubChem CID | 115371155 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one |
| SMILES | Cc1ccc(CN2CCCNC2=O)cn1 |
| InChI | InChI=1S/C11H15N3O/c1-9-3-4-10(7-13-9)8-14-6-2-5-12-11(14)15/h3-4,7H,2,5-6,8H2,1H3,(H,12,15) |
| InChIKey | BMNMLKBWDUIZGX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one?
The IUPAC name of 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one (CID 115371155) is 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one.
What is the SMILES notation for 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one?
The canonical SMILES for 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one is Cc1ccc(CN2CCCNC2=O)cn1.
What is the InChIKey of 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one?
The InChIKey is BMNMLKBWDUIZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-9-3-4-10(7-13-9)8-14-6-2-5-12-11(14)15/h3-4,7H,2,5-6,8H2,1H3,(H,12,15).
What are the key properties of 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one?
1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one has a molecular weight of 205.26 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-methyl-3-pyridinyl)methyl]-1,3-diazinan-2-one is sourced from PubChem (CID 115371155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).