C13H16N2 — CID 62993324
5-[(2,5-dimethylpyrrol-1-yl)methyl]-2-methylpyridine (PubChem CID 62993324) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-[(2,5-dimethylpyrrol-1-yl)methyl]-2-methylpyridine.
| Compound Name | 5-[(2,5-dimethylpyrrol-1-yl)methyl]-2-methylpyridine |
|---|---|
| PubChem CID | 62993324 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 5-[(2,5-dimethylpyrrol-1-yl)methyl]-2-methylpyridine |
| SMILES | Cc1ccc(Cn2c(C)ccc2C)cn1 |
| InChI | InChI=1S/C13H16N2/c1-10-4-7-13(8-14-10)9-15-11(2)5-6-12(15)3/h4-8H,9H2,1-3H3 |
| InChIKey | QRMMTRNPPQHZSQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |