C14H19N3 — CID 142030159
2,5-dimethylpyrimidine;5-ethyl-2-methylpyridine (PubChem CID 142030159) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 2,5-dimethylpyrimidine;5-ethyl-2-methylpyridine.
| Compound Name | 2,5-dimethylpyrimidine;5-ethyl-2-methylpyridine |
|---|---|
| PubChem CID | 142030159 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2,5-dimethylpyrimidine;5-ethyl-2-methylpyridine |
| SMILES | CCc1ccc(C)nc1.Cc1cnc(C)nc1 |
| InChI | InChI=1S/C8H11N.C6H8N2/c1-3-8-5-4-7(2)9-6-8;1-5-3-7-6(2)8-4-5/h4-6H,3H2,1-2H3;3-4H,1-2H3 |
| InChIKey | NXCHFCBAZHPTRS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |