C19H32N4 — CID 168923800
2-tert-butyl-5-ethylpyrimidine;ethane;(6-methyl-3-pyridinyl)methanamine (PubChem CID 168923800) has the molecular formula C19H32N4 and a molecular weight of 316.49 g/mol. Its IUPAC name is 2-tert-butyl-5-ethylpyrimidine;ethane;(6-methyl-3-pyridinyl)methanamine.
| Compound Name | 2-tert-butyl-5-ethylpyrimidine;ethane;(6-methyl-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 168923800 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 2-tert-butyl-5-ethylpyrimidine;ethane;(6-methyl-3-pyridinyl)methanamine |
| SMILES | CC.CCc1cnc(C(C)(C)C)nc1.Cc1ccc(CN)cn1 |
| InChI | InChI=1S/C10H16N2.C7H10N2.C2H6/c1-5-8-6-11-9(12-7-8)10(2,3)4;1-6-2-3-7(4-8)5-9-6;1-2/h6-7H,5H2,1-4H3;2-3,5H,4,8H2,1H3;1-2H3 |
| InChIKey | YRCJMQKAGAZWAS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |