About dipropylphosphane;ethane;5-ethyl-2-methylpyridine
dipropylphosphane;ethane;5-ethyl-2-methylpyridine (PubChem CID 143652926) has the molecular formula C16H32NP
and a molecular weight of 269.41 g/mol. Its IUPAC name is dipropylphosphane;ethane;5-ethyl-2-methylpyridine.
Molecular Properties
| Compound Name | dipropylphosphane;ethane;5-ethyl-2-methylpyridine |
| PubChem CID | 143652926 |
| Molecular Formula | C16H32NP |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.23 |
| IUPAC Name | dipropylphosphane;ethane;5-ethyl-2-methylpyridine |
| SMILES | CC.CCCPCCC.CCc1ccc(C)nc1 |
| InChI | InChI=1S/C8H11N.C6H15P.C2H6/c1-3-8-5-4-7(2)9-6-8;1-3-5-7-6-4-2;1-2/h4-6H,3H2,1-2H3;7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | SMATWEJZMDKRDX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipropylphosphane;ethane;5-ethyl-2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropylphosphane;ethane;5-ethyl-2-methylpyridine?
The IUPAC name of dipropylphosphane;ethane;5-ethyl-2-methylpyridine (CID 143652926) is dipropylphosphane;ethane;5-ethyl-2-methylpyridine.
What is the SMILES notation for dipropylphosphane;ethane;5-ethyl-2-methylpyridine?
The canonical SMILES for dipropylphosphane;ethane;5-ethyl-2-methylpyridine is CC.CCCPCCC.CCc1ccc(C)nc1.
What is the InChIKey of dipropylphosphane;ethane;5-ethyl-2-methylpyridine?
The InChIKey is SMATWEJZMDKRDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C6H15P.C2H6/c1-3-8-5-4-7(2)9-6-8;1-3-5-7-6-4-2;1-2/h4-6H,3H2,1-2H3;7H,3-6H2,1-2H3;1-2H3.
What are the key properties of dipropylphosphane;ethane;5-ethyl-2-methylpyridine?
dipropylphosphane;ethane;5-ethyl-2-methylpyridine has a molecular weight of 269.41 g/mol, XLogP of 5.46, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dipropylphosphane;ethane;5-ethyl-2-methylpyridine is sourced from PubChem (CID 143652926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).