C7H13N3 — CID 161178837
2,5-dimethylpyrimidine;methanamine (PubChem CID 161178837) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 2,5-dimethylpyrimidine;methanamine.
| Compound Name | 2,5-dimethylpyrimidine;methanamine |
|---|---|
| PubChem CID | 161178837 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2,5-dimethylpyrimidine;methanamine |
| SMILES | CN.Cc1cnc(C)nc1 |
| InChI | InChI=1S/C6H8N2.CH5N/c1-5-3-7-6(2)8-4-5;1-2/h3-4H,1-2H3;2H2,1H3 |
| InChIKey | USECUJYLIUEGNN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |