C10H16BrNO2 — CID 115371331
methyl (2R)-1-(2-bromoprop-2-enyl)piperidine-2-carboxylate (PubChem CID 115371331) has the molecular formula C10H16BrNO2 and a molecular weight of 262.15 g/mol. Its IUPAC name is methyl (2R)-1-(2-bromoprop-2-enyl)piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(2-bromoprop-2-enyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115371331 |
| Molecular Formula | C10H16BrNO2 |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | methyl (2R)-1-(2-bromoprop-2-enyl)piperidine-2-carboxylate |
| SMILES | C=C(Br)CN1CCCC[C@@H]1C(=O)OC |
| InChI | InChI=1S/C10H16BrNO2/c1-8(11)7-12-6-4-3-5-9(12)10(13)14-2/h9H,1,3-7H2,2H3/t9-/m1/s1 |
| InChIKey | FUNNGTDPAAXAOJ-SECBINFHSA-N |
| XLogP | 1.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |