C13H21N3O4 — CID 47129787
methyl 1-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperidine-2-carboxylate (PubChem CID 47129787) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl 1-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 47129787 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | methyl 1-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperidine-2-carboxylate |
| SMILES | C=CCNC(=O)NC(=O)CN1CCCCC1C(=O)OC |
| InChI | InChI=1S/C13H21N3O4/c1-3-7-14-13(19)15-11(17)9-16-8-5-4-6-10(16)12(18)20-2/h3,10H,1,4-9H2,2H3,(H2,14,15,17,19) |
| InChIKey | JVXNPEMNEKFCTN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|