C14H23N3O4 — CID 62215982
3-[1-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperidin-2-yl]propanoic acid (PubChem CID 62215982) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-[1-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperidin-2-yl]propanoic acid.
| Compound Name | 3-[1-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 62215982 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-[1-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperidin-2-yl]propanoic acid |
| SMILES | C=CCNC(=O)NC(=O)CN1CCCCC1CCC(=O)O |
| InChI | InChI=1S/C14H23N3O4/c1-2-8-15-14(21)16-12(18)10-17-9-4-3-5-11(17)6-7-13(19)20/h2,11H,1,3-10H2,(H,19,20)(H2,15,16,18,21) |
| InChIKey | CIDRCPNULCMXBB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|