C13H22N4O4 — CID 43522344
3-[4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazin-1-yl]propanoic acid (PubChem CID 43522344) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-[4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 43522344 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 3-[4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazin-1-yl]propanoic acid |
| SMILES | C=CCNC(=O)NC(=O)CN1CCN(CCC(=O)O)CC1 |
| InChI | InChI=1S/C13H22N4O4/c1-2-4-14-13(21)15-11(18)10-17-8-6-16(7-9-17)5-3-12(19)20/h2H,1,3-10H2,(H,19,20)(H2,14,15,18,21) |
| InChIKey | MKKCPZLCLAORNC-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|