C16H27N5O3 — CID 43037834
N-cyclopropyl-2-[4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazin-1-yl]propanamide (PubChem CID 43037834) has the molecular formula C16H27N5O3 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazin-1-yl]propanamide.
| Compound Name | N-cyclopropyl-2-[4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 43037834 |
| Molecular Formula | C16H27N5O3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | N-cyclopropyl-2-[4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazin-1-yl]propanamide |
| SMILES | C=CCNC(=O)NC(=O)CN1CCN(C(C)C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C16H27N5O3/c1-3-6-17-16(24)19-14(22)11-20-7-9-21(10-8-20)12(2)15(23)18-13-4-5-13/h3,12-13H,1,4-11H2,2H3,(H,18,23)(H2,17,19,22,24) |
| InChIKey | LGEQNNGAXFAUGJ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|