C15H28N4O3 — CID 30722149
(2R)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 30722149) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2R)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | (2R)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 30722149 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (2R)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@@H](C)N1CCN(CC(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C15H28N4O3/c1-12(15(21)16-5-10-22-2)19-8-6-18(7-9-19)11-14(20)17-13-3-4-13/h12-13H,3-11H2,1-2H3,(H,16,21)(H,17,20)/t12-/m1/s1 |
| InChIKey | DSXOESALNBJJGR-GFCCVEGCSA-N |
| XLogP | -0.97 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|