C22H42N4O3 — CID 30738203
N-(2-methoxyethyl)-2-[4-[2-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]-2-oxoethyl]piperazin-1-yl]acetamide (PubChem CID 30738203) has the molecular formula C22H42N4O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-[2-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]-2-oxoethyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[4-[2-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]-2-oxoethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30738203 |
| Molecular Formula | C22H42N4O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-[2-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]-2-oxoethyl]piperazin-1-yl]acetamide |
| SMILES | CCC(C)(C)C1CCC(NC(=O)CN2CCN(CC(=O)NCCOC)CC2)CC1 |
| InChI | InChI=1S/C22H42N4O3/c1-5-22(2,3)18-6-8-19(9-7-18)24-21(28)17-26-13-11-25(12-14-26)16-20(27)23-10-15-29-4/h18-19H,5-17H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | QJGVCFZZBANUQD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|