C18H25FN4O2 — CID 30736100
(2R)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(4-fluorophenyl)propanamide (PubChem CID 30736100) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is (2R)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(4-fluorophenyl)propanamide.
| Compound Name | (2R)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 30736100 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2R)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(4-fluorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)cc1)N1CCN(CC(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C18H25FN4O2/c1-13(18(25)21-16-4-2-14(19)3-5-16)23-10-8-22(9-11-23)12-17(24)20-15-6-7-15/h2-5,13,15H,6-12H2,1H3,(H,20,24)(H,21,25)/t13-/m1/s1 |
| InChIKey | CAYNXZYWAYVILN-CYBMUJFWSA-N |
| XLogP | 1.05 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |