C18H27FN4O2 — CID 8774104
(2R)-N-(4-fluorophenyl)-2-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]propanamide (PubChem CID 8774104) has the molecular formula C18H27FN4O2 and a molecular weight of 350.44 g/mol. Its IUPAC name is (2R)-N-(4-fluorophenyl)-2-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(4-fluorophenyl)-2-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 8774104 |
| Molecular Formula | C18H27FN4O2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2R)-N-(4-fluorophenyl)-2-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]propanamide |
| SMILES | CC(C)NC(=O)CN1CCN([C@H](C)C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H27FN4O2/c1-13(2)20-17(24)12-22-8-10-23(11-9-22)14(3)18(25)21-16-6-4-15(19)5-7-16/h4-7,13-14H,8-12H2,1-3H3,(H,20,24)(H,21,25)/t14-/m1/s1 |
| InChIKey | YBSRBNFLOKONLN-CQSZACIVSA-N |
| XLogP | 1.29 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |