C28H31FN4O2 — CID 30628505
(2R)-N-benzhydryl-2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]propanamide (PubChem CID 30628505) has the molecular formula C28H31FN4O2 and a molecular weight of 474.58 g/mol. Its IUPAC name is (2R)-N-benzhydryl-2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-benzhydryl-2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30628505 |
| Molecular Formula | C28H31FN4O2 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (2R)-N-benzhydryl-2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC(c1ccccc1)c1ccccc1)N1CCN(CC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H31FN4O2/c1-21(28(35)31-27(22-8-4-2-5-9-22)23-10-6-3-7-11-23)33-18-16-32(17-19-33)20-26(34)30-25-14-12-24(29)13-15-25/h2-15,21,27H,16-20H2,1H3,(H,30,34)(H,31,35)/t21-/m1/s1 |
| InChIKey | HAQUYVBXMUPLIB-OAQYLSRUSA-N |
| XLogP | 3.68 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |