C21H22Cl3FN4O2 — CID 55364731
2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 55364731) has the molecular formula C21H22Cl3FN4O2 and a molecular weight of 487.79 g/mol. Its IUPAC name is 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 55364731 |
| Molecular Formula | C21H22Cl3FN4O2 |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | CC(C(=O)Nc1cc(Cl)c(Cl)cc1Cl)N1CCN(CC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H22Cl3FN4O2/c1-13(21(31)27-19-11-17(23)16(22)10-18(19)24)29-8-6-28(7-9-29)12-20(30)26-15-4-2-14(25)3-5-15/h2-5,10-11,13H,6-9,12H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | BVRLXJLWQWAERS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|