C30H36N4O2 — CID 30955884
(2S)-N-benzhydryl-2-[4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazin-1-yl]propanamide (PubChem CID 30955884) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is (2S)-N-benzhydryl-2-[4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-benzhydryl-2-[4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30955884 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | (2S)-N-benzhydryl-2-[4-[2-(2,6-dimethylanilino)-2-oxoethyl]piperazin-1-yl]propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCN([C@@H](C)C(=O)NC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H36N4O2/c1-22-11-10-12-23(2)28(22)31-27(35)21-33-17-19-34(20-18-33)24(3)30(36)32-29(25-13-6-4-7-14-25)26-15-8-5-9-16-26/h4-16,24,29H,17-21H2,1-3H3,(H,31,35)(H,32,36)/t24-/m0/s1 |
| InChIKey | IUTAQJWFVPYFBF-DEOSSOPVSA-N |
| XLogP | 4.15 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |