C19H28N4O2 — CID 30739585
(2S)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(4-methylphenyl)propanamide (PubChem CID 30739585) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (2S)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(4-methylphenyl)propanamide.
| Compound Name | (2S)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 30739585 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (2S)-2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](C)N2CCN(CC(=O)NC3CC3)CC2)cc1 |
| InChI | InChI=1S/C19H28N4O2/c1-14-3-5-17(6-4-14)21-19(25)15(2)23-11-9-22(10-12-23)13-18(24)20-16-7-8-16/h3-6,15-16H,7-13H2,1-2H3,(H,20,24)(H,21,25)/t15-/m0/s1 |
| InChIKey | SUDKLIWQNMFWJR-HNNXBMFYSA-N |
| XLogP | 1.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |