C21H34N4O3 — CID 55432632
2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-phenylpropyl)propanamide (PubChem CID 55432632) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-phenylpropyl)propanamide.
| Compound Name | 2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 55432632 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-phenylpropyl)propanamide |
| SMILES | COCCNC(=O)CN1CCN(C(C)C(=O)NCC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H34N4O3/c1-17(19-7-5-4-6-8-19)15-23-21(27)18(2)25-12-10-24(11-13-25)16-20(26)22-9-14-28-3/h4-8,17-18H,9-16H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | ZUPVAUKCIVECBL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|