C19H29ClN4O3 — CID 24507244
N-[(2-chlorophenyl)methyl]-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]propanamide (PubChem CID 24507244) has the molecular formula C19H29ClN4O3 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 24507244 |
| Molecular Formula | C19H29ClN4O3 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]propanamide |
| SMILES | COCCNC(=O)CN1CCN(C(C)C(=O)NCc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H29ClN4O3/c1-15(19(26)22-13-16-5-3-4-6-17(16)20)24-10-8-23(9-11-24)14-18(25)21-7-12-27-2/h3-6,15H,7-14H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | KYPOXBKTNSRRKO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|