C20H26ClN5O3 — CID 78827736
2-[4-[1-[(2-chlorophenyl)methyl]pyrazole-4-carbonyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 78827736) has the molecular formula C20H26ClN5O3 and a molecular weight of 419.91 g/mol. Its IUPAC name is 2-[4-[1-[(2-chlorophenyl)methyl]pyrazole-4-carbonyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[1-[(2-chlorophenyl)methyl]pyrazole-4-carbonyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 78827736 |
| Molecular Formula | C20H26ClN5O3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-[4-[1-[(2-chlorophenyl)methyl]pyrazole-4-carbonyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1CCN(C(=O)c2cnn(Cc3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C20H26ClN5O3/c1-29-11-6-22-19(27)15-24-7-9-25(10-8-24)20(28)17-12-23-26(14-17)13-16-4-2-3-5-18(16)21/h2-5,12,14H,6-11,13,15H2,1H3,(H,22,27) |
| InChIKey | YFHBPUNKLRSTTA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|