C21H33N5O4 — CID 55534126
N-[(2,4-dimethylphenyl)carbamoyl]-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]propanamide (PubChem CID 55534126) has the molecular formula C21H33N5O4 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)carbamoyl]-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]propanamide.
| Compound Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55534126 |
| Molecular Formula | C21H33N5O4 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]propanamide |
| SMILES | COCCNC(=O)CN1CCN(C(C)C(=O)NC(=O)Nc2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C21H33N5O4/c1-15-5-6-18(16(2)13-15)23-21(29)24-20(28)17(3)26-10-8-25(9-11-26)14-19(27)22-7-12-30-4/h5-6,13,17H,7-12,14H2,1-4H3,(H,22,27)(H2,23,24,28,29) |
| InChIKey | VGHZYEANDMRILZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|