C15H27N5O3 — CID 37193198
N,N-diethyl-4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazine-1-carboxamide (PubChem CID 37193198) has the molecular formula C15H27N5O3 and a molecular weight of 325.41 g/mol. Its IUPAC name is N,N-diethyl-4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 37193198 |
| Molecular Formula | C15H27N5O3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | N,N-diethyl-4-[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl]piperazine-1-carboxamide |
| SMILES | C=CCNC(=O)NC(=O)CN1CCN(C(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C15H27N5O3/c1-4-7-16-14(22)17-13(21)12-18-8-10-20(11-9-18)15(23)19(5-2)6-3/h4H,1,5-12H2,2-3H3,(H2,16,17,21,22) |
| InChIKey | GXODKGANBJPTLD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|